C15H23N3O3 — CID 114765592
3-[(4-carbamoyl-6-methyl-2-pyridinyl)amino]-5,5-dimethylhexanoic acid (PubChem CID 114765592) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is 3-[(4-carbamoyl-6-methyl-2-pyridinyl)amino]-5,5-dimethylhexanoic acid.
| Compound Name | 3-[(4-carbamoyl-6-methyl-2-pyridinyl)amino]-5,5-dimethylhexanoic acid |
|---|---|
| PubChem CID | 114765592 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 3-[(4-carbamoyl-6-methyl-2-pyridinyl)amino]-5,5-dimethylhexanoic acid |
| SMILES | Cc1cc(C(N)=O)cc(NC(CC(=O)O)CC(C)(C)C)n1 |
| InChI | InChI=1S/C15H23N3O3/c1-9-5-10(14(16)21)6-12(17-9)18-11(7-13(19)20)8-15(2,3)4/h5-6,11H,7-8H2,1-4H3,(H2,16,21)(H,17,18)(H,19,20) |
| InChIKey | WPRVYJWDXHJGIH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |