C14H16N4S2 — CID 114767423
2-methyl-6-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)pyridine-4-carbothioamide (PubChem CID 114767423) has the molecular formula C14H16N4S2 and a molecular weight of 304.44 g/mol. Its IUPAC name is 2-methyl-6-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)pyridine-4-carbothioamide.
| Compound Name | 2-methyl-6-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)pyridine-4-carbothioamide |
|---|---|
| PubChem CID | 114767423 |
| Molecular Formula | C14H16N4S2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 2-methyl-6-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)pyridine-4-carbothioamide |
| SMILES | Cc1cc(C(N)=S)cc(Nc2nc3c(s2)CCCC3)n1 |
| InChI | InChI=1S/C14H16N4S2/c1-8-6-9(13(15)19)7-12(16-8)18-14-17-10-4-2-3-5-11(10)20-14/h6-7H,2-5H2,1H3,(H2,15,19)(H,16,17,18) |
| InChIKey | XCXLHTDUXJBIDT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|