C14H14ClN3S2 — CID 63520477
4-chloro-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)benzenecarbothioamide (PubChem CID 63520477) has the molecular formula C14H14ClN3S2 and a molecular weight of 323.87 g/mol. Its IUPAC name is 4-chloro-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)benzenecarbothioamide.
| Compound Name | 4-chloro-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 63520477 |
| Molecular Formula | C14H14ClN3S2 |
| Molecular Weight | 323.87 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 4-chloro-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(Cl)cc1Nc1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C14H14ClN3S2/c15-8-5-6-9(13(16)19)11(7-8)18-14-17-10-3-1-2-4-12(10)20-14/h5-7H,1-4H2,(H2,16,19)(H,17,18) |
| InChIKey | PHDVSPZPBOXPIZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.87 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|