C24H22N6S2 — CID 6417950
1-(6-phenylpyridazin-3-yl)-3-[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)phenyl]thiourea (PubChem CID 6417950) has the molecular formula C24H22N6S2 and a molecular weight of 458.62 g/mol. Its IUPAC name is 1-(6-phenylpyridazin-3-yl)-3-[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)phenyl]thiourea.
| Compound Name | 1-(6-phenylpyridazin-3-yl)-3-[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)phenyl]thiourea |
|---|---|
| PubChem CID | 6417950 |
| Molecular Formula | C24H22N6S2 |
| Molecular Weight | 458.62 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 1-(6-phenylpyridazin-3-yl)-3-[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)phenyl]thiourea |
| SMILES | S=C(Nc1ccc(-c2ccccc2)nn1)Nc1ccccc1Nc1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C24H22N6S2/c31-23(28-22-15-14-17(29-30-22)16-8-2-1-3-9-16)25-18-10-4-5-11-19(18)26-24-27-20-12-6-7-13-21(20)32-24/h1-5,8-11,14-15H,6-7,12-13H2,(H,26,27)(H2,25,28,30,31) |
| InChIKey | WCGYJPQKZDUZMW-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.62 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|