C24H18BrN7S — CID 6417814
1-[2-[(6-bromo-1H-indazol-3-yl)amino]phenyl]-3-(6-phenylpyridazin-3-yl)thiourea (PubChem CID 6417814) has the molecular formula C24H18BrN7S and a molecular weight of 516.43 g/mol. Its IUPAC name is 1-[2-[(6-bromo-1H-indazol-3-yl)amino]phenyl]-3-(6-phenylpyridazin-3-yl)thiourea.
| Compound Name | 1-[2-[(6-bromo-1H-indazol-3-yl)amino]phenyl]-3-(6-phenylpyridazin-3-yl)thiourea |
|---|---|
| PubChem CID | 6417814 |
| Molecular Formula | C24H18BrN7S |
| Molecular Weight | 516.43 g/mol |
| Exact Mass | 515.05 |
| IUPAC Name | 1-[2-[(6-bromo-1H-indazol-3-yl)amino]phenyl]-3-(6-phenylpyridazin-3-yl)thiourea |
| SMILES | S=C(Nc1ccc(-c2ccccc2)nn1)Nc1ccccc1Nc1n[nH]c2cc(Br)ccc12 |
| InChI | InChI=1S/C24H18BrN7S/c25-16-10-11-17-21(14-16)30-32-23(17)26-19-8-4-5-9-20(19)27-24(33)28-22-13-12-18(29-31-22)15-6-2-1-3-7-15/h1-14H,(H2,26,30,32)(H2,27,28,31,33) |
| InChIKey | BLCSICSCLPVYTN-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.43 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|