C27H28N6O2S2 — CID 6417697
methyl 5-pentan-3-yl-2-[2-[(6-phenylpyridazin-3-yl)carbamothioylamino]anilino]-1,3-thiazole-4-carboxylate (PubChem CID 6417697) has the molecular formula C27H28N6O2S2 and a molecular weight of 532.70 g/mol. Its IUPAC name is methyl 5-pentan-3-yl-2-[2-[(6-phenylpyridazin-3-yl)carbamothioylamino]anilino]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 5-pentan-3-yl-2-[2-[(6-phenylpyridazin-3-yl)carbamothioylamino]anilino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 6417697 |
| Molecular Formula | C27H28N6O2S2 |
| Molecular Weight | 532.70 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | methyl 5-pentan-3-yl-2-[2-[(6-phenylpyridazin-3-yl)carbamothioylamino]anilino]-1,3-thiazole-4-carboxylate |
| SMILES | CCC(CC)c1sc(Nc2ccccc2NC(=S)Nc2ccc(-c3ccccc3)nn2)nc1C(=O)OC |
| InChI | InChI=1S/C27H28N6O2S2/c1-4-17(5-2)24-23(25(34)35-3)31-27(37-24)29-21-14-10-9-13-20(21)28-26(36)30-22-16-15-19(32-33-22)18-11-7-6-8-12-18/h6-17H,4-5H2,1-3H3,(H,29,31)(H2,28,30,33,36) |
| InChIKey | YWOZRWYLLVVSSL-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.70 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|