C26H19ClN6S2 — CID 6417836
1-[2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]phenyl]-3-(6-phenylpyridazin-3-yl)thiourea (PubChem CID 6417836) has the molecular formula C26H19ClN6S2 and a molecular weight of 515.07 g/mol. Its IUPAC name is 1-[2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]phenyl]-3-(6-phenylpyridazin-3-yl)thiourea.
| Compound Name | 1-[2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]phenyl]-3-(6-phenylpyridazin-3-yl)thiourea |
|---|---|
| PubChem CID | 6417836 |
| Molecular Formula | C26H19ClN6S2 |
| Molecular Weight | 515.07 g/mol |
| Exact Mass | 514.08 |
| IUPAC Name | 1-[2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]phenyl]-3-(6-phenylpyridazin-3-yl)thiourea |
| SMILES | S=C(Nc1ccc(-c2ccccc2)nn1)Nc1ccccc1Nc1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C26H19ClN6S2/c27-19-12-10-18(11-13-19)23-16-35-26(30-23)29-22-9-5-4-8-21(22)28-25(34)31-24-15-14-20(32-33-24)17-6-2-1-3-7-17/h1-16H,(H,29,30)(H2,28,31,33,34) |
| InChIKey | KFZXWGLVOQHJGV-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.07 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|