C22H17F3N8OS — CID 6417847
1-[2-[[1-amino-6-oxo-4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-3-(6-phenylpyridazin-3-yl)thiourea (PubChem CID 6417847) has the molecular formula C22H17F3N8OS and a molecular weight of 498.49 g/mol. Its IUPAC name is 1-[2-[[1-amino-6-oxo-4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-3-(6-phenylpyridazin-3-yl)thiourea.
| Compound Name | 1-[2-[[1-amino-6-oxo-4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-3-(6-phenylpyridazin-3-yl)thiourea |
|---|---|
| PubChem CID | 6417847 |
| Molecular Formula | C22H17F3N8OS |
| Molecular Weight | 498.49 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | 1-[2-[[1-amino-6-oxo-4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-3-(6-phenylpyridazin-3-yl)thiourea |
| SMILES | Nn1c(Nc2ccccc2NC(=S)Nc2ccc(-c3ccccc3)nn2)nc(C(F)(F)F)cc1=O |
| InChI | InChI=1S/C22H17F3N8OS/c23-22(24,25)17-12-19(34)33(26)20(29-17)27-15-8-4-5-9-16(15)28-21(35)30-18-11-10-14(31-32-18)13-6-2-1-3-7-13/h1-12H,26H2,(H,27,29)(H2,28,30,32,35) |
| InChIKey | DNSNKRURALZDQS-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 122.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|