C24H22N6O2S2 — CID 6417905
[2-[(6-phenylpyridazin-3-yl)carbamothioylamino]phenyl]methyl 2-(2-amino-5-methyl-1,3-thiazol-4-yl)acetate (PubChem CID 6417905) has the molecular formula C24H22N6O2S2 and a molecular weight of 490.61 g/mol. Its IUPAC name is [2-[(6-phenylpyridazin-3-yl)carbamothioylamino]phenyl]methyl 2-(2-amino-5-methyl-1,3-thiazol-4-yl)acetate.
| Compound Name | [2-[(6-phenylpyridazin-3-yl)carbamothioylamino]phenyl]methyl 2-(2-amino-5-methyl-1,3-thiazol-4-yl)acetate |
|---|---|
| PubChem CID | 6417905 |
| Molecular Formula | C24H22N6O2S2 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | [2-[(6-phenylpyridazin-3-yl)carbamothioylamino]phenyl]methyl 2-(2-amino-5-methyl-1,3-thiazol-4-yl)acetate |
| SMILES | Cc1sc(N)nc1CC(=O)OCc1ccccc1NC(=S)Nc1ccc(-c2ccccc2)nn1 |
| InChI | InChI=1S/C24H22N6O2S2/c1-15-20(26-23(25)34-15)13-22(31)32-14-17-9-5-6-10-18(17)27-24(33)28-21-12-11-19(29-30-21)16-7-3-2-4-8-16/h2-12H,13-14H2,1H3,(H2,25,26)(H2,27,28,30,33) |
| InChIKey | VWPULZRCFCCUMH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|