C25H22N6O3 — CID 6417633
1-[2-[[3-(carbamoylamino)phenoxy]methyl]phenyl]-3-(6-phenylpyridazin-3-yl)urea (PubChem CID 6417633) has the molecular formula C25H22N6O3 and a molecular weight of 454.49 g/mol. Its IUPAC name is 1-[2-[[3-(carbamoylamino)phenoxy]methyl]phenyl]-3-(6-phenylpyridazin-3-yl)urea.
| Compound Name | 1-[2-[[3-(carbamoylamino)phenoxy]methyl]phenyl]-3-(6-phenylpyridazin-3-yl)urea |
|---|---|
| PubChem CID | 6417633 |
| Molecular Formula | C25H22N6O3 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 1-[2-[[3-(carbamoylamino)phenoxy]methyl]phenyl]-3-(6-phenylpyridazin-3-yl)urea |
| SMILES | NC(=O)Nc1cccc(OCc2ccccc2NC(=O)Nc2ccc(-c3ccccc3)nn2)c1 |
| InChI | InChI=1S/C25H22N6O3/c26-24(32)27-19-10-6-11-20(15-19)34-16-18-9-4-5-12-21(18)28-25(33)29-23-14-13-22(30-31-23)17-7-2-1-3-8-17/h1-15H,16H2,(H3,26,27,32)(H2,28,29,31,33) |
| InChIKey | LZCBFJHASOQHDJ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 131.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |