C25H20N6O2 — CID 6417653
1-[2-[(6-amino-1,3-benzoxazol-2-yl)methyl]phenyl]-3-(6-phenylpyridazin-3-yl)urea (PubChem CID 6417653) has the molecular formula C25H20N6O2 and a molecular weight of 436.48 g/mol. Its IUPAC name is 1-[2-[(6-amino-1,3-benzoxazol-2-yl)methyl]phenyl]-3-(6-phenylpyridazin-3-yl)urea.
| Compound Name | 1-[2-[(6-amino-1,3-benzoxazol-2-yl)methyl]phenyl]-3-(6-phenylpyridazin-3-yl)urea |
|---|---|
| PubChem CID | 6417653 |
| Molecular Formula | C25H20N6O2 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 1-[2-[(6-amino-1,3-benzoxazol-2-yl)methyl]phenyl]-3-(6-phenylpyridazin-3-yl)urea |
| SMILES | Nc1ccc2nc(Cc3ccccc3NC(=O)Nc3ccc(-c4ccccc4)nn3)oc2c1 |
| InChI | InChI=1S/C25H20N6O2/c26-18-10-11-21-22(15-18)33-24(27-21)14-17-8-4-5-9-19(17)28-25(32)29-23-13-12-20(30-31-23)16-6-2-1-3-7-16/h1-13,15H,14,26H2,(H2,28,29,31,32) |
| InChIKey | JTFHOAYJEKSSPM-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 118.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|