C26H22ClN5O3 — CID 6417465
[2-[(6-phenylpyridazin-3-yl)carbamoylamino]phenyl] 3-amino-3-(4-chlorophenyl)propanoate (PubChem CID 6417465) has the molecular formula C26H22ClN5O3 and a molecular weight of 487.95 g/mol. Its IUPAC name is [2-[(6-phenylpyridazin-3-yl)carbamoylamino]phenyl] 3-amino-3-(4-chlorophenyl)propanoate.
| Compound Name | [2-[(6-phenylpyridazin-3-yl)carbamoylamino]phenyl] 3-amino-3-(4-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 6417465 |
| Molecular Formula | C26H22ClN5O3 |
| Molecular Weight | 487.95 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | [2-[(6-phenylpyridazin-3-yl)carbamoylamino]phenyl] 3-amino-3-(4-chlorophenyl)propanoate |
| SMILES | NC(CC(=O)Oc1ccccc1NC(=O)Nc1ccc(-c2ccccc2)nn1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H22ClN5O3/c27-19-12-10-17(11-13-19)20(28)16-25(33)35-23-9-5-4-8-22(23)29-26(34)30-24-15-14-21(31-32-24)18-6-2-1-3-7-18/h1-15,20H,16,28H2,(H2,29,30,32,34) |
| InChIKey | CMWBALOLSCKDNU-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.95 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|