C27H26N6O3 — CID 6841216
[2-[[N'-(6-phenylpyridazin-3-yl)carbamimidoyl]amino]phenyl] 3-amino-3-(4-methoxyphenyl)propanoate (PubChem CID 6841216) has the molecular formula C27H26N6O3 and a molecular weight of 482.54 g/mol. Its IUPAC name is [2-[[N'-(6-phenylpyridazin-3-yl)carbamimidoyl]amino]phenyl] 3-amino-3-(4-methoxyphenyl)propanoate.
| Compound Name | [2-[[N'-(6-phenylpyridazin-3-yl)carbamimidoyl]amino]phenyl] 3-amino-3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 6841216 |
| Molecular Formula | C27H26N6O3 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | [2-[[N'-(6-phenylpyridazin-3-yl)carbamimidoyl]amino]phenyl] 3-amino-3-(4-methoxyphenyl)propanoate |
| SMILES | COc1ccc(C(N)CC(=O)Oc2ccccc2N/C(N)=N/c2ccc(-c3ccccc3)nn2)cc1 |
| InChI | InChI=1S/C27H26N6O3/c1-35-20-13-11-18(12-14-20)21(28)17-26(34)36-24-10-6-5-9-23(24)30-27(29)31-25-16-15-22(32-33-25)19-7-3-2-4-8-19/h2-16,21H,17,28H2,1H3,(H3,29,30,31,33) |
| InChIKey | WXSKRRWTYJVVCG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 137.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|