C29H25N7O — CID 6841342
1-[2-[[4-(3-amino-2-pyridinyl)phenoxy]methyl]phenyl]-2-(6-phenylpyridazin-3-yl)guanidine (PubChem CID 6841342) has the molecular formula C29H25N7O and a molecular weight of 487.57 g/mol. Its IUPAC name is 1-[2-[[4-(3-amino-2-pyridinyl)phenoxy]methyl]phenyl]-2-(6-phenylpyridazin-3-yl)guanidine.
| Compound Name | 1-[2-[[4-(3-amino-2-pyridinyl)phenoxy]methyl]phenyl]-2-(6-phenylpyridazin-3-yl)guanidine |
|---|---|
| PubChem CID | 6841342 |
| Molecular Formula | C29H25N7O |
| Molecular Weight | 487.57 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | 1-[2-[[4-(3-amino-2-pyridinyl)phenoxy]methyl]phenyl]-2-(6-phenylpyridazin-3-yl)guanidine |
| SMILES | N/C(=N\c1ccc(-c2ccccc2)nn1)Nc1ccccc1COc1ccc(-c2ncccc2N)cc1 |
| InChI | InChI=1S/C29H25N7O/c30-24-10-6-18-32-28(24)21-12-14-23(15-13-21)37-19-22-9-4-5-11-25(22)33-29(31)34-27-17-16-26(35-36-27)20-7-2-1-3-8-20/h1-18H,19,30H2,(H3,31,33,34,36) |
| InChIKey | XPKLBTJTGPGOLR-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 124.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.57 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|