C22H17N7S — CID 6841251
1-[2-[(3-cyanothiophen-2-yl)amino]phenyl]-2-(6-phenylpyridazin-3-yl)guanidine (PubChem CID 6841251) has the molecular formula C22H17N7S and a molecular weight of 411.49 g/mol. Its IUPAC name is 1-[2-[(3-cyanothiophen-2-yl)amino]phenyl]-2-(6-phenylpyridazin-3-yl)guanidine.
| Compound Name | 1-[2-[(3-cyanothiophen-2-yl)amino]phenyl]-2-(6-phenylpyridazin-3-yl)guanidine |
|---|---|
| PubChem CID | 6841251 |
| Molecular Formula | C22H17N7S |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 1-[2-[(3-cyanothiophen-2-yl)amino]phenyl]-2-(6-phenylpyridazin-3-yl)guanidine |
| SMILES | N#Cc1ccsc1Nc1ccccc1N/C(N)=N/c1ccc(-c2ccccc2)nn1 |
| InChI | InChI=1S/C22H17N7S/c23-14-16-12-13-30-21(16)25-18-8-4-5-9-19(18)26-22(24)27-20-11-10-17(28-29-20)15-6-2-1-3-7-15/h1-13,25H,(H3,24,26,27,29) |
| InChIKey | VICPAWBDGSFMHO-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|