C24H18F3N9 — CID 6841408
2-(6-phenylpyridazin-3-yl)-1-[2-[[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-8-yl]amino]phenyl]guanidine (PubChem CID 6841408) has the molecular formula C24H18F3N9 and a molecular weight of 489.47 g/mol. Its IUPAC name is 2-(6-phenylpyridazin-3-yl)-1-[2-[[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-8-yl]amino]phenyl]guanidine.
| Compound Name | 2-(6-phenylpyridazin-3-yl)-1-[2-[[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-8-yl]amino]phenyl]guanidine |
|---|---|
| PubChem CID | 6841408 |
| Molecular Formula | C24H18F3N9 |
| Molecular Weight | 489.47 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 2-(6-phenylpyridazin-3-yl)-1-[2-[[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-8-yl]amino]phenyl]guanidine |
| SMILES | N/C(=N\c1ccc(-c2ccccc2)nn1)Nc1ccccc1Nc1cccn2c(C(F)(F)F)nnc12 |
| InChI | InChI=1S/C24H18F3N9/c25-24(26,27)22-35-34-21-19(11-6-14-36(21)22)29-17-9-4-5-10-18(17)30-23(28)31-20-13-12-16(32-33-20)15-7-2-1-3-8-15/h1-14,29H,(H3,28,30,31,33) |
| InChIKey | ZHJVHKLLSOFDSP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.47 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|