C23H21N7O2S — CID 6841325
ethyl 2-[2-[[N'-(6-phenylpyridazin-3-yl)carbamimidoyl]amino]anilino]-1,3-thiazole-4-carboxylate (PubChem CID 6841325) has the molecular formula C23H21N7O2S and a molecular weight of 459.54 g/mol. Its IUPAC name is ethyl 2-[2-[[N'-(6-phenylpyridazin-3-yl)carbamimidoyl]amino]anilino]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[2-[[N'-(6-phenylpyridazin-3-yl)carbamimidoyl]amino]anilino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 6841325 |
| Molecular Formula | C23H21N7O2S |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | ethyl 2-[2-[[N'-(6-phenylpyridazin-3-yl)carbamimidoyl]amino]anilino]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(Nc2ccccc2N/C(N)=N/c2ccc(-c3ccccc3)nn2)n1 |
| InChI | InChI=1S/C23H21N7O2S/c1-2-32-21(31)19-14-33-23(27-19)26-18-11-7-6-10-17(18)25-22(24)28-20-13-12-16(29-30-20)15-8-4-3-5-9-15/h3-14H,2H2,1H3,(H,26,27)(H3,24,25,28,30) |
| InChIKey | YQNRAJJFHVFJMA-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 127.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|