C27H20ClN7O2S — CID 6841155
5-(2-chlorophenyl)-2-[2-[[N'-(6-phenylpyridazin-3-yl)carbamimidoyl]amino]anilino]-1,3-thiazole-4-carboxylic acid (PubChem CID 6841155) has the molecular formula C27H20ClN7O2S and a molecular weight of 542.02 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-2-[2-[[N'-(6-phenylpyridazin-3-yl)carbamimidoyl]amino]anilino]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-(2-chlorophenyl)-2-[2-[[N'-(6-phenylpyridazin-3-yl)carbamimidoyl]amino]anilino]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 6841155 |
| Molecular Formula | C27H20ClN7O2S |
| Molecular Weight | 542.02 g/mol |
| Exact Mass | 541.11 |
| IUPAC Name | 5-(2-chlorophenyl)-2-[2-[[N'-(6-phenylpyridazin-3-yl)carbamimidoyl]amino]anilino]-1,3-thiazole-4-carboxylic acid |
| SMILES | N/C(=N\c1ccc(-c2ccccc2)nn1)Nc1ccccc1Nc1nc(C(=O)O)c(-c2ccccc2Cl)s1 |
| InChI | InChI=1S/C27H20ClN7O2S/c28-18-11-5-4-10-17(18)24-23(25(36)37)33-27(38-24)31-21-13-7-6-12-20(21)30-26(29)32-22-15-14-19(34-35-22)16-8-2-1-3-9-16/h1-15H,(H,31,33)(H,36,37)(H3,29,30,32,35) |
| InChIKey | VCJYTWJGDGAJBR-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 138.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.02 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|