C28H22N8OS — CID 6417766
1-[2-[[4-(5-amino-4-cyanopyrazol-1-yl)phenoxy]methyl]phenyl]-3-(6-phenylpyridazin-3-yl)thiourea (PubChem CID 6417766) has the molecular formula C28H22N8OS and a molecular weight of 518.61 g/mol. Its IUPAC name is 1-[2-[[4-(5-amino-4-cyanopyrazol-1-yl)phenoxy]methyl]phenyl]-3-(6-phenylpyridazin-3-yl)thiourea.
| Compound Name | 1-[2-[[4-(5-amino-4-cyanopyrazol-1-yl)phenoxy]methyl]phenyl]-3-(6-phenylpyridazin-3-yl)thiourea |
|---|---|
| PubChem CID | 6417766 |
| Molecular Formula | C28H22N8OS |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | 1-[2-[[4-(5-amino-4-cyanopyrazol-1-yl)phenoxy]methyl]phenyl]-3-(6-phenylpyridazin-3-yl)thiourea |
| SMILES | N#Cc1cnn(-c2ccc(OCc3ccccc3NC(=S)Nc3ccc(-c4ccccc4)nn3)cc2)c1N |
| InChI | InChI=1S/C28H22N8OS/c29-16-21-17-31-36(27(21)30)22-10-12-23(13-11-22)37-18-20-8-4-5-9-24(20)32-28(38)33-26-15-14-25(34-35-26)19-6-2-1-3-7-19/h1-15,17H,18,30H2,(H2,32,33,35,38) |
| InChIKey | INUNHWJXGSJVNA-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 126.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|