C26H20N8S — CID 6417947
1-[2-[3-(4-aminopyrimidin-2-yl)-4-pyridinyl]phenyl]-3-(6-phenylpyridazin-3-yl)thiourea (PubChem CID 6417947) has the molecular formula C26H20N8S and a molecular weight of 476.57 g/mol. Its IUPAC name is 1-[2-[3-(4-aminopyrimidin-2-yl)-4-pyridinyl]phenyl]-3-(6-phenylpyridazin-3-yl)thiourea.
| Compound Name | 1-[2-[3-(4-aminopyrimidin-2-yl)-4-pyridinyl]phenyl]-3-(6-phenylpyridazin-3-yl)thiourea |
|---|---|
| PubChem CID | 6417947 |
| Molecular Formula | C26H20N8S |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | 1-[2-[3-(4-aminopyrimidin-2-yl)-4-pyridinyl]phenyl]-3-(6-phenylpyridazin-3-yl)thiourea |
| SMILES | Nc1ccnc(-c2cnccc2-c2ccccc2NC(=S)Nc2ccc(-c3ccccc3)nn2)n1 |
| InChI | InChI=1S/C26H20N8S/c27-23-13-15-29-25(31-23)20-16-28-14-12-18(20)19-8-4-5-9-22(19)30-26(35)32-24-11-10-21(33-34-24)17-6-2-1-3-7-17/h1-16H,(H2,27,29,31)(H2,30,32,34,35) |
| InChIKey | NPMKESUDAIDKFO-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|