C24H27N5O2S — CID 6417770
[2-[(6-phenylpyridazin-3-yl)carbamothioylamino]phenyl] 3-amino-5-methylhexanoate (PubChem CID 6417770) has the molecular formula C24H27N5O2S and a molecular weight of 449.58 g/mol. Its IUPAC name is [2-[(6-phenylpyridazin-3-yl)carbamothioylamino]phenyl] 3-amino-5-methylhexanoate.
| Compound Name | [2-[(6-phenylpyridazin-3-yl)carbamothioylamino]phenyl] 3-amino-5-methylhexanoate |
|---|---|
| PubChem CID | 6417770 |
| Molecular Formula | C24H27N5O2S |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | [2-[(6-phenylpyridazin-3-yl)carbamothioylamino]phenyl] 3-amino-5-methylhexanoate |
| SMILES | CC(C)CC(N)CC(=O)Oc1ccccc1NC(=S)Nc1ccc(-c2ccccc2)nn1 |
| InChI | InChI=1S/C24H27N5O2S/c1-16(2)14-18(25)15-23(30)31-21-11-7-6-10-20(21)26-24(32)27-22-13-12-19(28-29-22)17-8-4-3-5-9-17/h3-13,16,18H,14-15,25H2,1-2H3,(H2,26,27,29,32) |
| InChIKey | ZNXXCVYWVOTGEM-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|