C24H21N5O2S2 — CID 6417801
[2-[(6-phenylpyridazin-3-yl)carbamothioylamino]phenyl] 3-amino-3-thiophen-3-ylpropanoate (PubChem CID 6417801) has the molecular formula C24H21N5O2S2 and a molecular weight of 475.60 g/mol. Its IUPAC name is [2-[(6-phenylpyridazin-3-yl)carbamothioylamino]phenyl] 3-amino-3-thiophen-3-ylpropanoate.
| Compound Name | [2-[(6-phenylpyridazin-3-yl)carbamothioylamino]phenyl] 3-amino-3-thiophen-3-ylpropanoate |
|---|---|
| PubChem CID | 6417801 |
| Molecular Formula | C24H21N5O2S2 |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | [2-[(6-phenylpyridazin-3-yl)carbamothioylamino]phenyl] 3-amino-3-thiophen-3-ylpropanoate |
| SMILES | NC(CC(=O)Oc1ccccc1NC(=S)Nc1ccc(-c2ccccc2)nn1)c1ccsc1 |
| InChI | InChI=1S/C24H21N5O2S2/c25-18(17-12-13-33-15-17)14-23(30)31-21-9-5-4-8-20(21)26-24(32)27-22-11-10-19(28-29-22)16-6-2-1-3-7-16/h1-13,15,18H,14,25H2,(H2,26,27,29,32) |
| InChIKey | SUPUXOIWDIEUDZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|