C28H26N6OS — CID 6417821
1-[2-[4-(5-amino-1,3-benzoxazol-2-yl)butyl]phenyl]-3-(6-phenylpyridazin-3-yl)thiourea (PubChem CID 6417821) has the molecular formula C28H26N6OS and a molecular weight of 494.62 g/mol. Its IUPAC name is 1-[2-[4-(5-amino-1,3-benzoxazol-2-yl)butyl]phenyl]-3-(6-phenylpyridazin-3-yl)thiourea.
| Compound Name | 1-[2-[4-(5-amino-1,3-benzoxazol-2-yl)butyl]phenyl]-3-(6-phenylpyridazin-3-yl)thiourea |
|---|---|
| PubChem CID | 6417821 |
| Molecular Formula | C28H26N6OS |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | 1-[2-[4-(5-amino-1,3-benzoxazol-2-yl)butyl]phenyl]-3-(6-phenylpyridazin-3-yl)thiourea |
| SMILES | Nc1ccc2oc(CCCCc3ccccc3NC(=S)Nc3ccc(-c4ccccc4)nn3)nc2c1 |
| InChI | InChI=1S/C28H26N6OS/c29-21-14-16-25-24(18-21)30-27(35-25)13-7-5-11-19-10-4-6-12-22(19)31-28(36)32-26-17-15-23(33-34-26)20-8-2-1-3-9-20/h1-4,6,8-10,12,14-18H,5,7,11,13,29H2,(H2,31,32,34,36) |
| InChIKey | VHELVCLAVYLXJO-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 101.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|