C26H25N7O2 — CID 6417667
1-[2-[(6-morpholin-4-yl-3-pyridinyl)amino]phenyl]-3-(6-phenylpyridazin-3-yl)urea (PubChem CID 6417667) has the molecular formula C26H25N7O2 and a molecular weight of 467.53 g/mol. Its IUPAC name is 1-[2-[(6-morpholin-4-yl-3-pyridinyl)amino]phenyl]-3-(6-phenylpyridazin-3-yl)urea.
| Compound Name | 1-[2-[(6-morpholin-4-yl-3-pyridinyl)amino]phenyl]-3-(6-phenylpyridazin-3-yl)urea |
|---|---|
| PubChem CID | 6417667 |
| Molecular Formula | C26H25N7O2 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 1-[2-[(6-morpholin-4-yl-3-pyridinyl)amino]phenyl]-3-(6-phenylpyridazin-3-yl)urea |
| SMILES | O=C(Nc1ccc(-c2ccccc2)nn1)Nc1ccccc1Nc1ccc(N2CCOCC2)nc1 |
| InChI | InChI=1S/C26H25N7O2/c34-26(30-24-12-11-21(31-32-24)19-6-2-1-3-7-19)29-23-9-5-4-8-22(23)28-20-10-13-25(27-18-20)33-14-16-35-17-15-33/h1-13,18,28H,14-17H2,(H2,29,30,32,34) |
| InChIKey | XCCCZLQTZQQLTF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 104.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |