C21H18ClN3O3 — CID 171062561
2-[[2-[(3-chlorophenyl)carbamoylamino]phenyl]methoxy]benzamide (PubChem CID 171062561) has the molecular formula C21H18ClN3O3 and a molecular weight of 395.85 g/mol. Its IUPAC name is 2-[[2-[(3-chlorophenyl)carbamoylamino]phenyl]methoxy]benzamide.
| Compound Name | 2-[[2-[(3-chlorophenyl)carbamoylamino]phenyl]methoxy]benzamide |
|---|---|
| PubChem CID | 171062561 |
| Molecular Formula | C21H18ClN3O3 |
| Molecular Weight | 395.85 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 2-[[2-[(3-chlorophenyl)carbamoylamino]phenyl]methoxy]benzamide |
| SMILES | NC(=O)c1ccccc1OCc1ccccc1NC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H18ClN3O3/c22-15-7-5-8-16(12-15)24-21(27)25-18-10-3-1-6-14(18)13-28-19-11-4-2-9-17(19)20(23)26/h1-12H,13H2,(H2,23,26)(H2,24,25,27) |
| InChIKey | SYHNOJYOKQNGTL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.85 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |