C22H16ClFN4O2 — CID 118709305
1-(3-chlorophenyl)-3-[6-[(2-fluorophenyl)methoxy]quinazolin-7-yl]urea (PubChem CID 118709305) has the molecular formula C22H16ClFN4O2 and a molecular weight of 422.85 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[6-[(2-fluorophenyl)methoxy]quinazolin-7-yl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[6-[(2-fluorophenyl)methoxy]quinazolin-7-yl]urea |
|---|---|
| PubChem CID | 118709305 |
| Molecular Formula | C22H16ClFN4O2 |
| Molecular Weight | 422.85 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[6-[(2-fluorophenyl)methoxy]quinazolin-7-yl]urea |
| SMILES | O=C(Nc1cccc(Cl)c1)Nc1cc2ncncc2cc1OCc1ccccc1F |
| InChI | InChI=1S/C22H16ClFN4O2/c23-16-5-3-6-17(9-16)27-22(29)28-20-10-19-15(11-25-13-26-19)8-21(20)30-12-14-4-1-2-7-18(14)24/h1-11,13H,12H2,(H2,27,28,29) |
| InChIKey | ZJIIDJPMZPVSFP-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.85 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |