C28H20ClN7O2 — CID 6417463
1-[2-[[3-(3-chlorophenoxy)-1,1-dicyanoprop-1-en-2-yl]amino]phenyl]-3-(6-phenylpyridazin-3-yl)urea (PubChem CID 6417463) has the molecular formula C28H20ClN7O2 and a molecular weight of 521.97 g/mol. Its IUPAC name is 1-[2-[[3-(3-chlorophenoxy)-1,1-dicyanoprop-1-en-2-yl]amino]phenyl]-3-(6-phenylpyridazin-3-yl)urea.
| Compound Name | 1-[2-[[3-(3-chlorophenoxy)-1,1-dicyanoprop-1-en-2-yl]amino]phenyl]-3-(6-phenylpyridazin-3-yl)urea |
|---|---|
| PubChem CID | 6417463 |
| Molecular Formula | C28H20ClN7O2 |
| Molecular Weight | 521.97 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | 1-[2-[[3-(3-chlorophenoxy)-1,1-dicyanoprop-1-en-2-yl]amino]phenyl]-3-(6-phenylpyridazin-3-yl)urea |
| SMILES | N#CC(C#N)=C(COc1cccc(Cl)c1)Nc1ccccc1NC(=O)Nc1ccc(-c2ccccc2)nn1 |
| InChI | InChI=1S/C28H20ClN7O2/c29-21-9-6-10-22(15-21)38-18-26(20(16-30)17-31)32-24-11-4-5-12-25(24)33-28(37)34-27-14-13-23(35-36-27)19-7-2-1-3-8-19/h1-15,32H,18H2,(H2,33,34,36,37) |
| InChIKey | BTYMLZCJVPFTNQ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 135.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.97 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|