C13H14N4OS — CID 115545359
2-amino-3-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-ylamino)benzamide (PubChem CID 115545359) has the molecular formula C13H14N4OS and a molecular weight of 274.35 g/mol. Its IUPAC name is 2-amino-3-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-ylamino)benzamide.
| Compound Name | 2-amino-3-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-ylamino)benzamide |
|---|---|
| PubChem CID | 115545359 |
| Molecular Formula | C13H14N4OS |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 2-amino-3-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-ylamino)benzamide |
| SMILES | NC(=O)c1cccc(Nc2nc3c(s2)CCC3)c1N |
| InChI | InChI=1S/C13H14N4OS/c14-11-7(12(15)18)3-1-5-9(11)17-13-16-8-4-2-6-10(8)19-13/h1,3,5H,2,4,6,14H2,(H2,15,18)(H,16,17) |
| InChIKey | DWRQGULMHXEOBR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|