C16H17N3S — CID 114767786
2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethylamino)-6-methylpyridine-4-carbothioamide (PubChem CID 114767786) has the molecular formula C16H17N3S and a molecular weight of 283.40 g/mol. Its IUPAC name is 2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethylamino)-6-methylpyridine-4-carbothioamide.
| Compound Name | 2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethylamino)-6-methylpyridine-4-carbothioamide |
|---|---|
| PubChem CID | 114767786 |
| Molecular Formula | C16H17N3S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethylamino)-6-methylpyridine-4-carbothioamide |
| SMILES | Cc1cc(C(N)=S)cc(NCC2Cc3ccccc32)n1 |
| InChI | InChI=1S/C16H17N3S/c1-10-6-12(16(17)20)8-15(19-10)18-9-13-7-11-4-2-3-5-14(11)13/h2-6,8,13H,7,9H2,1H3,(H2,17,20)(H,18,19) |
| InChIKey | OZXZQFADRPSNLQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|