C13H8F3N3S — CID 114769418
2-methyl-6-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]pyridine-4-carbonitrile (PubChem CID 114769418) has the molecular formula C13H8F3N3S and a molecular weight of 295.29 g/mol. Its IUPAC name is 2-methyl-6-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]pyridine-4-carbonitrile.
| Compound Name | 2-methyl-6-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 114769418 |
| Molecular Formula | C13H8F3N3S |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 2-methyl-6-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]pyridine-4-carbonitrile |
| SMILES | Cc1cc(C#N)cc(Sc2ccc(C(F)(F)F)cn2)n1 |
| InChI | InChI=1S/C13H8F3N3S/c1-8-4-9(6-17)5-12(19-8)20-11-3-2-10(7-18-11)13(14,15)16/h2-5,7H,1H3 |
| InChIKey | CJLSKEYKKTWYPL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |