C12H8F3N3O2S — CID 107555126
6-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]pyrimidine-4-carboxylic acid (PubChem CID 107555126) has the molecular formula C12H8F3N3O2S and a molecular weight of 315.28 g/mol. Its IUPAC name is 6-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]pyrimidine-4-carboxylic acid.
| Compound Name | 6-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 107555126 |
| Molecular Formula | C12H8F3N3O2S |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 6-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]pyrimidine-4-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)nc(Sc2ccc(C(F)(F)F)cn2)n1 |
| InChI | InChI=1S/C12H8F3N3O2S/c1-6-4-8(10(19)20)18-11(17-6)21-9-3-2-7(5-16-9)12(13,14)15/h2-5H,1H3,(H,19,20) |
| InChIKey | VFTPFLQFPYRNCX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |