C13H7F4NO2S — CID 62648414
3-fluoro-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]benzoic acid (PubChem CID 62648414) has the molecular formula C13H7F4NO2S and a molecular weight of 317.26 g/mol. Its IUPAC name is 3-fluoro-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]benzoic acid.
| Compound Name | 3-fluoro-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]benzoic acid |
|---|---|
| PubChem CID | 62648414 |
| Molecular Formula | C13H7F4NO2S |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | 3-fluoro-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]benzoic acid |
| SMILES | O=C(O)c1cccc(F)c1Sc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C13H7F4NO2S/c14-9-3-1-2-8(12(19)20)11(9)21-10-5-4-7(6-18-10)13(15,16)17/h1-6H,(H,19,20) |
| InChIKey | HDGNJNCYNCLFRL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |