C13H11F3N2S — CID 102818650
[3-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]phenyl]methanamine (PubChem CID 102818650) has the molecular formula C13H11F3N2S and a molecular weight of 284.31 g/mol. Its IUPAC name is [3-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]phenyl]methanamine.
| Compound Name | [3-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]phenyl]methanamine |
|---|---|
| PubChem CID | 102818650 |
| Molecular Formula | C13H11F3N2S |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | [3-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]phenyl]methanamine |
| SMILES | NCc1cccc(Sc2ccc(C(F)(F)F)cn2)c1 |
| InChI | InChI=1S/C13H11F3N2S/c14-13(15,16)10-4-5-12(18-8-10)19-11-3-1-2-9(6-11)7-17/h1-6,8H,7,17H2 |
| InChIKey | GRQYNJHVFBFWLD-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |