C13H10F4N2S — CID 63673671
[5-fluoro-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]phenyl]methanamine (PubChem CID 63673671) has the molecular formula C13H10F4N2S and a molecular weight of 302.30 g/mol. Its IUPAC name is [5-fluoro-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]phenyl]methanamine.
| Compound Name | [5-fluoro-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]phenyl]methanamine |
|---|---|
| PubChem CID | 63673671 |
| Molecular Formula | C13H10F4N2S |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | [5-fluoro-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]phenyl]methanamine |
| SMILES | NCc1cc(F)ccc1Sc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C13H10F4N2S/c14-10-2-3-11(8(5-10)6-18)20-12-4-1-9(7-19-12)13(15,16)17/h1-5,7H,6,18H2 |
| InChIKey | SDQLTCPCRYWOFQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |