C11H8F3NS3 — CID 20623707
[4-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]thiophen-3-yl]methanethiol (PubChem CID 20623707) has the molecular formula C11H8F3NS3 and a molecular weight of 307.39 g/mol. Its IUPAC name is [4-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]thiophen-3-yl]methanethiol.
| Compound Name | [4-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]thiophen-3-yl]methanethiol |
|---|---|
| PubChem CID | 20623707 |
| Molecular Formula | C11H8F3NS3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 306.98 |
| IUPAC Name | [4-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]thiophen-3-yl]methanethiol |
| SMILES | FC(F)(F)c1ccc(Sc2cscc2CS)nc1 |
| InChI | InChI=1S/C11H8F3NS3/c12-11(13,14)8-1-2-10(15-3-8)18-9-6-17-5-7(9)4-16/h1-3,5-6,16H,4H2 |
| InChIKey | XIUAUFDOTROKQD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|