C9H7F3N4S — CID 78969097
4-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-1H-pyrazol-5-amine (PubChem CID 78969097) has the molecular formula C9H7F3N4S and a molecular weight of 260.24 g/mol. Its IUPAC name is 4-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-1H-pyrazol-5-amine.
| Compound Name | 4-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 78969097 |
| Molecular Formula | C9H7F3N4S |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 4-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-1H-pyrazol-5-amine |
| SMILES | Nc1[nH]ncc1Sc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C9H7F3N4S/c10-9(11,12)5-1-2-7(14-3-5)17-6-4-15-16-8(6)13/h1-4H,(H3,13,15,16) |
| InChIKey | SRORNEJYLKVQNX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |