C15H14F3NOS — CID 103960715
(1S)-1-[2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]phenyl]propan-1-ol (PubChem CID 103960715) has the molecular formula C15H14F3NOS and a molecular weight of 313.34 g/mol. Its IUPAC name is (1S)-1-[2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]phenyl]propan-1-ol.
| Compound Name | (1S)-1-[2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]phenyl]propan-1-ol |
|---|---|
| PubChem CID | 103960715 |
| Molecular Formula | C15H14F3NOS |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | (1S)-1-[2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]phenyl]propan-1-ol |
| SMILES | CC[C@H](O)c1ccccc1Sc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C15H14F3NOS/c1-2-12(20)11-5-3-4-6-13(11)21-14-8-7-10(9-19-14)15(16,17)18/h3-9,12,20H,2H2,1H3/t12-/m0/s1 |
| InChIKey | AIRKKAQDDPNHHU-LBPRGKRZSA-N |
| XLogP | 4.70 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |