C14H12ClF3N2S — CID 63805451
1-[2-chloro-6-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]phenyl]-N-methylmethanamine (PubChem CID 63805451) has the molecular formula C14H12ClF3N2S and a molecular weight of 332.78 g/mol. Its IUPAC name is 1-[2-chloro-6-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]phenyl]-N-methylmethanamine.
| Compound Name | 1-[2-chloro-6-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]phenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 63805451 |
| Molecular Formula | C14H12ClF3N2S |
| Molecular Weight | 332.78 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 1-[2-chloro-6-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]phenyl]-N-methylmethanamine |
| SMILES | CNCc1c(Cl)cccc1Sc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C14H12ClF3N2S/c1-19-8-10-11(15)3-2-4-12(10)21-13-6-5-9(7-20-13)14(16,17)18/h2-7,19H,8H2,1H3 |
| InChIKey | RKEVPQGHFIOMNF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.78 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |