C12H11F3N2S2 — CID 55020982
2-thiophen-2-yl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanamine (PubChem CID 55020982) has the molecular formula C12H11F3N2S2 and a molecular weight of 304.36 g/mol. Its IUPAC name is 2-thiophen-2-yl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanamine.
| Compound Name | 2-thiophen-2-yl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanamine |
|---|---|
| PubChem CID | 55020982 |
| Molecular Formula | C12H11F3N2S2 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 2-thiophen-2-yl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanamine |
| SMILES | NCC(Sc1ccc(C(F)(F)F)cn1)c1cccs1 |
| InChI | InChI=1S/C12H11F3N2S2/c13-12(14,15)8-3-4-11(17-7-8)19-10(6-16)9-2-1-5-18-9/h1-5,7,10H,6,16H2 |
| InChIKey | FMLWTGMRDVGDNZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |