C13H19F3N2OS — CID 114370116
3-amino-5-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]hexan-1-ol (PubChem CID 114370116) has the molecular formula C13H19F3N2OS and a molecular weight of 308.37 g/mol. Its IUPAC name is 3-amino-5-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]hexan-1-ol.
| Compound Name | 3-amino-5-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]hexan-1-ol |
|---|---|
| PubChem CID | 114370116 |
| Molecular Formula | C13H19F3N2OS |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 3-amino-5-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]hexan-1-ol |
| SMILES | CC(C)CC(N)C(CO)Sc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C13H19F3N2OS/c1-8(2)5-10(17)11(7-19)20-12-4-3-9(6-18-12)13(14,15)16/h3-4,6,8,10-11,19H,5,7,17H2,1-2H3 |
| InChIKey | YKOBIPCOTOHODW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |