C10H13F3N2OS — CID 64806386
2-(methylamino)-3-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]propan-1-ol (PubChem CID 64806386) has the molecular formula C10H13F3N2OS and a molecular weight of 266.29 g/mol. Its IUPAC name is 2-(methylamino)-3-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]propan-1-ol.
| Compound Name | 2-(methylamino)-3-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 64806386 |
| Molecular Formula | C10H13F3N2OS |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 2-(methylamino)-3-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]propan-1-ol |
| SMILES | CNC(CO)CSc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C10H13F3N2OS/c1-14-8(5-16)6-17-9-3-2-7(4-15-9)10(11,12)13/h2-4,8,14,16H,5-6H2,1H3 |
| InChIKey | OPGASUGBKAHABR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |