C11H13F3N2S — CID 64619378
1-cyclopropyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanamine (PubChem CID 64619378) has the molecular formula C11H13F3N2S and a molecular weight of 262.30 g/mol. Its IUPAC name is 1-cyclopropyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanamine.
| Compound Name | 1-cyclopropyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanamine |
|---|---|
| PubChem CID | 64619378 |
| Molecular Formula | C11H13F3N2S |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 1-cyclopropyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanamine |
| SMILES | NC(CSc1ccc(C(F)(F)F)cn1)C1CC1 |
| InChI | InChI=1S/C11H13F3N2S/c12-11(13,14)8-3-4-10(16-5-8)17-6-9(15)7-1-2-7/h3-5,7,9H,1-2,6,15H2 |
| InChIKey | SNVKQNQWKIYRAQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |