C14H19F3N2S — CID 104755276
1-cyclohexyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanamine (PubChem CID 104755276) has the molecular formula C14H19F3N2S and a molecular weight of 304.38 g/mol. Its IUPAC name is 1-cyclohexyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanamine.
| Compound Name | 1-cyclohexyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanamine |
|---|---|
| PubChem CID | 104755276 |
| Molecular Formula | C14H19F3N2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 1-cyclohexyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanamine |
| SMILES | NC(CSc1ccc(C(F)(F)F)cn1)C1CCCCC1 |
| InChI | InChI=1S/C14H19F3N2S/c15-14(16,17)11-6-7-13(19-8-11)20-9-12(18)10-4-2-1-3-5-10/h6-8,10,12H,1-5,9,18H2 |
| InChIKey | PVLCLTUPOPWAJX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |