C15H17F3NO2S+ — CID 149147420
[3-oxo-5-[1-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]propan-2-yl]cyclohexen-1-yl]oxidanium (PubChem CID 149147420) has the molecular formula C15H17F3NO2S+ and a molecular weight of 332.37 g/mol. Its IUPAC name is [3-oxo-5-[1-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]propan-2-yl]cyclohexen-1-yl]oxidanium.
| Compound Name | [3-oxo-5-[1-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]propan-2-yl]cyclohexen-1-yl]oxidanium |
|---|---|
| PubChem CID | 149147420 |
| Molecular Formula | C15H17F3NO2S+ |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | [3-oxo-5-[1-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]propan-2-yl]cyclohexen-1-yl]oxidanium |
| SMILES | CC(CSc1ccc(C(F)(F)F)cn1)C1CC(=O)C=C([OH2+])C1 |
| InChI | InChI=1S/C15H16F3NO2S/c1-9(10-4-12(20)6-13(21)5-10)8-22-14-3-2-11(7-19-14)15(16,17)18/h2-3,6-7,9-10,20H,4-5,8H2,1H3/p+1 |
| InChIKey | RLDGCSDZIAJPOV-UHFFFAOYSA-O |
| XLogP | 3.42 |
| TPSA | 52.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|