C11H14N6OS — CID 114769668
2-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-6-methylpyridine-4-carboximidamide (PubChem CID 114769668) has the molecular formula C11H14N6OS and a molecular weight of 278.34 g/mol. Its IUPAC name is 2-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-6-methylpyridine-4-carboximidamide.
| Compound Name | 2-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-6-methylpyridine-4-carboximidamide |
|---|---|
| PubChem CID | 114769668 |
| Molecular Formula | C11H14N6OS |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-6-methylpyridine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(C)nc(Sc2n[nH]c(=O)n2CC)c1 |
| InChI | InChI=1S/C11H14N6OS/c1-3-17-10(18)15-16-11(17)19-8-5-7(9(12)13)4-6(2)14-8/h4-5H,3H2,1-2H3,(H3,12,13)(H,15,18) |
| InChIKey | PSSRWTQYKTUTCK-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|