C9H15Cl2IO — CID 114772475
(1,4-dichloro-3-iodobutan-2-yl)oxycyclopentane (PubChem CID 114772475) has the molecular formula C9H15Cl2IO and a molecular weight of 337.03 g/mol. Its IUPAC name is (1,4-dichloro-3-iodobutan-2-yl)oxycyclopentane.
| Compound Name | (1,4-dichloro-3-iodobutan-2-yl)oxycyclopentane |
|---|---|
| PubChem CID | 114772475 |
| Molecular Formula | C9H15Cl2IO |
| Molecular Weight | 337.03 g/mol |
| Exact Mass | 335.95 |
| IUPAC Name | (1,4-dichloro-3-iodobutan-2-yl)oxycyclopentane |
| SMILES | ClCC(I)C(CCl)OC1CCCC1 |
| InChI | InChI=1S/C9H15Cl2IO/c10-5-8(12)9(6-11)13-7-3-1-2-4-7/h7-9H,1-6H2 |
| InChIKey | ILWKJJOJSMXHAA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.03 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|