C10H17BrCl2O — CID 114774644
(3-bromo-1,4-dichlorobutan-2-yl)oxymethylcyclopentane (PubChem CID 114774644) has the molecular formula C10H17BrCl2O and a molecular weight of 304.06 g/mol. Its IUPAC name is (3-bromo-1,4-dichlorobutan-2-yl)oxymethylcyclopentane.
| Compound Name | (3-bromo-1,4-dichlorobutan-2-yl)oxymethylcyclopentane |
|---|---|
| PubChem CID | 114774644 |
| Molecular Formula | C10H17BrCl2O |
| Molecular Weight | 304.06 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | (3-bromo-1,4-dichlorobutan-2-yl)oxymethylcyclopentane |
| SMILES | ClCC(Br)C(CCl)OCC1CCCC1 |
| InChI | InChI=1S/C10H17BrCl2O/c11-9(5-12)10(6-13)14-7-8-3-1-2-4-8/h8-10H,1-7H2 |
| InChIKey | ICLUZZLJGHIAHX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.06 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|