About 3-(cyclopentylmethoxy)-4,4,4-trifluorobutan-2-amine
3-(cyclopentylmethoxy)-4,4,4-trifluorobutan-2-amine (PubChem CID 66322799) has the molecular formula C10H18F3NO
and a molecular weight of 225.25 g/mol. Its IUPAC name is 3-(cyclopentylmethoxy)-4,4,4-trifluorobutan-2-amine.
Molecular Properties
| Compound Name | 3-(cyclopentylmethoxy)-4,4,4-trifluorobutan-2-amine |
| PubChem CID | 66322799 |
| Molecular Formula | C10H18F3NO |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 3-(cyclopentylmethoxy)-4,4,4-trifluorobutan-2-amine |
| SMILES | CC(N)C(OCC1CCCC1)C(F)(F)F |
| InChI | InChI=1S/C10H18F3NO/c1-7(14)9(10(11,12)13)15-6-8-4-2-3-5-8/h7-9H,2-6,14H2,1H3 |
| InChIKey | NTTSPQMEYNBIOD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(cyclopentylmethoxy)-4,4,4-trifluorobutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclopentylmethoxy)-4,4,4-trifluorobutan-2-amine?
The IUPAC name of 3-(cyclopentylmethoxy)-4,4,4-trifluorobutan-2-amine (CID 66322799) is 3-(cyclopentylmethoxy)-4,4,4-trifluorobutan-2-amine.
What is the SMILES notation for 3-(cyclopentylmethoxy)-4,4,4-trifluorobutan-2-amine?
The canonical SMILES for 3-(cyclopentylmethoxy)-4,4,4-trifluorobutan-2-amine is CC(N)C(OCC1CCCC1)C(F)(F)F.
What is the InChIKey of 3-(cyclopentylmethoxy)-4,4,4-trifluorobutan-2-amine?
The InChIKey is NTTSPQMEYNBIOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F3NO/c1-7(14)9(10(11,12)13)15-6-8-4-2-3-5-8/h7-9H,2-6,14H2,1H3.
What are the key properties of 3-(cyclopentylmethoxy)-4,4,4-trifluorobutan-2-amine?
3-(cyclopentylmethoxy)-4,4,4-trifluorobutan-2-amine has a molecular weight of 225.25 g/mol, XLogP of 2.47, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclopentylmethoxy)-4,4,4-trifluorobutan-2-amine is sourced from PubChem (CID 66322799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).