C10H19BrCl2O — CID 114773446
1-(3-bromo-1,4-dichlorobutan-2-yl)oxy-4-methylpentane (PubChem CID 114773446) has the molecular formula C10H19BrCl2O and a molecular weight of 306.07 g/mol. Its IUPAC name is 1-(3-bromo-1,4-dichlorobutan-2-yl)oxy-4-methylpentane.
| Compound Name | 1-(3-bromo-1,4-dichlorobutan-2-yl)oxy-4-methylpentane |
|---|---|
| PubChem CID | 114773446 |
| Molecular Formula | C10H19BrCl2O |
| Molecular Weight | 306.07 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | 1-(3-bromo-1,4-dichlorobutan-2-yl)oxy-4-methylpentane |
| SMILES | CC(C)CCCOC(CCl)C(Br)CCl |
| InChI | InChI=1S/C10H19BrCl2O/c1-8(2)4-3-5-14-10(7-13)9(11)6-12/h8-10H,3-7H2,1-2H3 |
| InChIKey | XCCYRVQPDVKOQQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.07 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|