C10H19BrCl2O2 — CID 106449019
2-bromo-1,4-dichloro-3-[2-(2-methylpropoxy)ethoxy]butane (PubChem CID 106449019) has the molecular formula C10H19BrCl2O2 and a molecular weight of 322.07 g/mol. Its IUPAC name is 2-bromo-1,4-dichloro-3-[2-(2-methylpropoxy)ethoxy]butane.
| Compound Name | 2-bromo-1,4-dichloro-3-[2-(2-methylpropoxy)ethoxy]butane |
|---|---|
| PubChem CID | 106449019 |
| Molecular Formula | C10H19BrCl2O2 |
| Molecular Weight | 322.07 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | 2-bromo-1,4-dichloro-3-[2-(2-methylpropoxy)ethoxy]butane |
| SMILES | CC(C)COCCOC(CCl)C(Br)CCl |
| InChI | InChI=1S/C10H19BrCl2O2/c1-8(2)7-14-3-4-15-10(6-13)9(11)5-12/h8-10H,3-7H2,1-2H3 |
| InChIKey | IGDMVKQBKHUVJP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.07 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|